cas: 161395-97-7 — see every product listed under this CAS number, including other names
3-Acetoxy-1-propenylboronic acid pinacol ester, 95-<97% (CAS 161395-97-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC185-95-97-5g |
| cas | 161395-97-7 |
| size | 5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 5g | 4359.30 Pln | |
| Hoffman Fine Chemicals | 10g | 6796.46 Pln | |
| Hoffman Fine Chemicals | 25g | 13278.54 Pln | |
| Hoffman Fine Chemicals | 50g | 21062.14 Pln | |
| Hoffman Fine Chemicals | 100g | 35589.40 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] acetate (CAS 161395-97-7) is a chemical compound with the molecular formula C11H19BO4 and a molecular weight of 226.08 g/mol. IUPAC name: [(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] acetate. InChIKey: ZXBRLGZFCXGTBA-VOTSOKGWSA-N.
| Molecular formula | C11H19BO4 |
|---|---|
| Molecular weight | 226.08 g/mol |
| IUPAC name | [(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] acetate |
| InChIKey | ZXBRLGZFCXGTBA-VOTSOKGWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/COC(=O)C |
Computed by PubChem (NCBI)