CAS 1204312-99-1 is the registry number for Methyl (E)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acrylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (E)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoate (CAS 1204312-99-1) is a chemical compound with the molecular formula C11H19BO4 and a molecular weight of 226.08 g/mol. IUPAC name: methyl (E)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoate. InChIKey: DYOCUQRWRFJJIB-BQYQJAHWSA-N.
| Molecular formula | C11H19BO4 |
|---|---|
| Molecular weight | 226.08 g/mol |
| IUPAC name | methyl (E)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoate |
| InChIKey | DYOCUQRWRFJJIB-BQYQJAHWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C(\C)/C(=O)OC |
Computed by PubChem (NCBI)