cas: 52816-65-6 — see every product listed under this CAS number, including other names
3-Acetyl-2-methyl-1,6-naphthyridine (CAS 52816-65-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023692-1G |
| cas | 52816-65-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1643.19 Pln | |
| Fluorochem | 5g | 4839.98 Pln |
| delivery time | 2-3 weeks |
|---|
1-(2-methyl-1,6-naphthyridin-3-yl)ethanone (CAS 52816-65-6) is a chemical compound with the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. IUPAC name: 1-(2-methyl-1,6-naphthyridin-3-yl)ethanone. InChIKey: IKNXDFVOTFRCCA-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 1-(2-methyl-1,6-naphthyridin-3-yl)ethanone |
| InChIKey | IKNXDFVOTFRCCA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C=NC=CC2=N1)C(=O)C |
Computed by PubChem (NCBI)