cas: 10372-41-5 — see every product listed under this CAS number, including other names
3-Amino- N , N -diethyl-benzenesulfonamide (CAS 10372-41-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F030807-250MG |
| cas | 10372-41-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 659.16 Pln | |
| Fluorochem | 5g | 1825.42 Pln | |
| Fluorochem | 10g | 3215.55 Pln | |
| Fluorochem | 25g | 6651.84 Pln |
| delivery time | 3-4 weeks |
|---|
3-amino-N,N-diethylbenzenesulfonamide (CAS 10372-41-5) is a chemical compound with the molecular formula C10H16N2O2S and a molecular weight of 228.31 g/mol. IUPAC name: 3-amino-N,N-diethylbenzenesulfonamide. InChIKey: CTBWWPIIRKWDDL-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | 3-amino-N,N-diethylbenzenesulfonamide |
| InChIKey | CTBWWPIIRKWDDL-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=CC(=C1)N |
Computed by PubChem (NCBI)