cas: 10372-41-5 — see every product listed under this CAS number, including other names
3-Amino-N,N-diethylbenzenesulfonamide 95% (CAS 10372-41-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A474925-250mg |
| cas | 10372-41-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 854.31 Pln | |
| Ambeed | 10g | 1377.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A474925 |
3-amino-N,N-diethylbenzenesulfonamide (CAS 10372-41-5) is a chemical compound with the molecular formula C10H16N2O2S and a molecular weight of 228.31 g/mol. IUPAC name: 3-amino-N,N-diethylbenzenesulfonamide. InChIKey: CTBWWPIIRKWDDL-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | 3-amino-N,N-diethylbenzenesulfonamide |
| InChIKey | CTBWWPIIRKWDDL-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=CC(=C1)N |
Computed by PubChem (NCBI)