cas: 13725-02-5 — see every product listed under this CAS number, including other names
3-Amino-1-benzylpiperidine-3-carboxylic acid, 98% (CAS 13725-02-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A616991-10g |
| cas | 13725-02-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 35614.60 Pln | |
| AmBeed | 5g | 24020.29 Pln | |
| Fluorochem | 100mg | 633.13 Pln | |
| Fluorochem | 250mg | 893.45 Pln | |
| Fluorochem | 1g | 1736.91 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-amino-1-benzylpiperidine-3-carboxylic acid (CAS 13725-02-5) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: 3-amino-1-benzylpiperidine-3-carboxylic acid. InChIKey: SIHICTGIUNQECV-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 3-amino-1-benzylpiperidine-3-carboxylic acid |
| InChIKey | SIHICTGIUNQECV-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC=CC=C2)(C(=O)O)N |
Computed by PubChem (NCBI)