Products 2229635-87-2

CAS 2229635-87-2 is the registry number for 3-Amino-2-((methylsulfonyl)methyl)propanoic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 1g, 250mg, 50mg.

Structural formula: {0} (CAS {1})

2-(aminomethyl)-3-methylsulfonylpropanoic acid (CAS 2229635-87-2) is a chemical compound with the molecular formula C5H11NO4S and a molecular weight of 181.21 g/mol. IUPAC name: 2-(aminomethyl)-3-methylsulfonylpropanoic acid. InChIKey: XNSHNCGLWHJODE-UHFFFAOYSA-N.

Identity
Molecular formulaC5H11NO4S
Molecular weight181.21 g/mol
IUPAC name2-(aminomethyl)-3-methylsulfonylpropanoic acid
InChIKeyXNSHNCGLWHJODE-UHFFFAOYSA-N
SMILESCS(=O)(=O)CC(CN)C(=O)O

Computed by PubChem (NCBI)