Products 1368407-84-4

CAS 1368407-84-4 appears in our catalog under these names: 2,2-Dimethyl-3-sulfamoylpropanoic acid, 95%, 2,2-Dimethyl-3-sulfamoylpropanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2,2-dimethyl-3-sulfamoylpropanoic acid (CAS 1368407-84-4) is a chemical compound with the molecular formula C5H11NO4S and a molecular weight of 181.21 g/mol. IUPAC name: 2,2-dimethyl-3-sulfamoylpropanoic acid. InChIKey: MPMGPQPSBRWURR-UHFFFAOYSA-N.

Identity
Molecular formulaC5H11NO4S
Molecular weight181.21 g/mol
IUPAC name2,2-dimethyl-3-sulfamoylpropanoic acid
InChIKeyMPMGPQPSBRWURR-UHFFFAOYSA-N
SMILESCC(C)(CS(=O)(=O)N)C(=O)O

Computed by PubChem (NCBI)