CAS 946784-63-0 appears in our catalog under these names: 4-(3-Methoxyphenoxy)-2-(trifluoromethyl)aniline, 97%, 4-(3-Methoxyphenoxy)-2-(trifluoromethyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-(3-methoxyphenoxy)-2-(trifluoromethyl)aniline (CAS 946784-63-0) is a chemical compound with the molecular formula C14H12F3NO2 and a molecular weight of 283.24 g/mol. IUPAC name: 4-(3-methoxyphenoxy)-2-(trifluoromethyl)aniline. InChIKey: VUPJYAKNRKKHKI-UHFFFAOYSA-N.
| Molecular formula | C14H12F3NO2 |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | 4-(3-methoxyphenoxy)-2-(trifluoromethyl)aniline |
| InChIKey | VUPJYAKNRKKHKI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC=C1)OC2=CC(=C(C=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)