cas: 29092-34-0 — see every product listed under this CAS number, including other names
3-Amino-4-chloro-benzenesulfonamide (CAS 29092-34-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g, 10g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | EBA09234-5g |
| cas | 29092-34-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 5g | price on request | |
| Biosynth | 0,5g | price on request | |
| Fluorochem | 100mg | 315.53 Pln | |
| Fluorochem | 250mg | 404.04 Pln | |
| Fluorochem | 1g | 862.21 Pln | |
| Fluorochem | 5g | 2788.62 Pln | |
| Fluorochem | 10g | 5438.73 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
3-amino-4-chlorobenzenesulfonamide (CAS 29092-34-0) is a chemical compound with the molecular formula C6H7ClN2O2S and a molecular weight of 206.65 g/mol. IUPAC name: 3-amino-4-chlorobenzenesulfonamide. InChIKey: OIWCPLBCWJUCMR-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O2S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | 3-amino-4-chlorobenzenesulfonamide |
| InChIKey | OIWCPLBCWJUCMR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)N)N)Cl |
Computed by PubChem (NCBI)