3-Amino-5-tert-butyl-2,3-dihydro-1H-indol-2-one hydrochloride, 95%
cas: 1461706-05-7 — see every product listed under this CAS number, including other names
3-Amino-5-tert-butyl-2,3-dihydro-1H-indol-2-one hydrochloride, 95% (CAS 1461706-05-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1036723-100mg |
| cas | 1461706-05-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 592.88 Pln | |
| Ambeed | 250mg | 948.88 Pln | |
| Ambeed | 1g | 2639.88 Pln | |
| Chemat | 100mg | 707.60 Pln | |
| Chemat | 250mg | 1158.80 Pln | |
| Chemat | 1g | 3016.40 Pln | |
| BLDpharm | 100mg | 636.47 Pln | |
| BLDpharm | 250mg | 1019.67 Pln | |
| BLDpharm | 1g | 2841.25 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-amino-5-tert-butyl-1,3-dihydroindol-2-one;hydrochloride (CAS 1461706-05-7) is a chemical compound with the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. IUPAC name: 3-amino-5-tert-butyl-1,3-dihydroindol-2-one;hydrochloride. InChIKey: FXTFOCNLHQTLFT-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O |
|---|---|
| Molecular weight | 240.73 g/mol |
| IUPAC name | 3-amino-5-tert-butyl-1,3-dihydroindol-2-one;hydrochloride |
| InChIKey | FXTFOCNLHQTLFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)NC(=O)C2N.Cl |
Computed by PubChem (NCBI)