Products 1461706-05-7
CAS 1461706-05-7 appears in our catalog under these names: 3-Amino-5-tert-butyl-2,3-dihydro-1H-indol-2-one hydrochloride, 95%, 3-AMINO-5-(TERT-BUTYL)INDOLIN-2-ONE HYDROCHLORIDE, 95%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-amino-5-tert-butyl-1,3-dihydroindol-2-one;hydrochloride (CAS 1461706-05-7) is a chemical compound with the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. IUPAC name: 3-amino-5-tert-butyl-1,3-dihydroindol-2-one;hydrochloride. InChIKey: FXTFOCNLHQTLFT-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O |
|---|---|
| Molecular weight | 240.73 g/mol |
| IUPAC name | 3-amino-5-tert-butyl-1,3-dihydroindol-2-one;hydrochloride |
| InChIKey | FXTFOCNLHQTLFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)NC(=O)C2N.Cl |
Computed by PubChem (NCBI)