cas: 249737-01-7 — see every product listed under this CAS number, including other names
3-Amino-6,7-dimethoxy-4-(trifluoromethyl)quinolin-2-ol, 95%, 95% (CAS 249737-01-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113Q2R-100mg |
| cas | 249737-01-7 |
| size | 100mg |
| availability | 1.45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 1029.20 Pln | |
| Chemat | 1g | 2474.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-amino-6,7-dimethoxy-4-(trifluoromethyl)-1H-quinolin-2-one (CAS 249737-01-7) is a chemical compound with the molecular formula C12H11F3N2O3 and a molecular weight of 288.22 g/mol. IUPAC name: 3-amino-6,7-dimethoxy-4-(trifluoromethyl)-1H-quinolin-2-one. InChIKey: HWKBZAFQRULOJK-UHFFFAOYSA-N.
| Molecular formula | C12H11F3N2O3 |
|---|---|
| Molecular weight | 288.22 g/mol |
| IUPAC name | 3-amino-6,7-dimethoxy-4-(trifluoromethyl)-1H-quinolin-2-one |
| InChIKey | HWKBZAFQRULOJK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=C(C(=O)N2)N)C(F)(F)F)OC |
Computed by PubChem (NCBI)