Products 861881-16-5
CAS 861881-16-5 is the registry number for 3,3-Dimethyl-1-(2-nitro-4-(trifluoromethyl)phenyl)azetidin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
3,3-dimethyl-1-[2-nitro-4-(trifluoromethyl)phenyl]azetidin-2-one (CAS 861881-16-5) is a chemical compound with the molecular formula C12H11F3N2O3 and a molecular weight of 288.22 g/mol. IUPAC name: 3,3-dimethyl-1-[2-nitro-4-(trifluoromethyl)phenyl]azetidin-2-one. InChIKey: HBYVRAUVTHVMPD-UHFFFAOYSA-N.
| Molecular formula | C12H11F3N2O3 |
|---|---|
| Molecular weight | 288.22 g/mol |
| IUPAC name | 3,3-dimethyl-1-[2-nitro-4-(trifluoromethyl)phenyl]azetidin-2-one |
| InChIKey | HBYVRAUVTHVMPD-UHFFFAOYSA-N |
| SMILES | CC1(CN(C1=O)C2=C(C=C(C=C2)C(F)(F)F)[N+](=O)[O-])C |
Computed by PubChem (NCBI)