cas: 98-18-0 — see every product listed under this CAS number, including other names
3-Aminobenzenesulfonamide, 97%, 97% (CAS 98-18-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116W73-1g |
| cas | 98-18-0 |
| size | 1g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 122.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-aminobenzenesulfonamide (CAS 98-18-0) is a chemical compound with the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. IUPAC name: 3-aminobenzenesulfonamide. InChIKey: JPVKCHIPRSQDKL-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O2S |
|---|---|
| Molecular weight | 172.21 g/mol |
| IUPAC name | 3-aminobenzenesulfonamide |
| InChIKey | JPVKCHIPRSQDKL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)N)N |
Computed by PubChem (NCBI)