cas: 98-18-0 — see every product listed under this CAS number, including other names
3-Aminobenzenesulfonamide, 97% (CAS 98-18-0) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F068167-500G |
| cas | 98-18-0 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500g | 1507.82 Pln | |
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 96.86 Pln | |
| Fluorochem | 10g | 112.48 Pln | |
| Fluorochem | 25g | 159.34 Pln | |
| Fluorochem | 100g | 388.42 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-aminobenzenesulfonamide (CAS 98-18-0) is a chemical compound with the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. IUPAC name: 3-aminobenzenesulfonamide. InChIKey: JPVKCHIPRSQDKL-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O2S |
|---|---|
| Molecular weight | 172.21 g/mol |
| IUPAC name | 3-aminobenzenesulfonamide |
| InChIKey | JPVKCHIPRSQDKL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)N)N |
Computed by PubChem (NCBI)