cas: 850567-51-0 — see every product listed under this CAS number, including other names
3-Aminophenylboronic acid, pinacol ester, HCl, ≥98%, ≥98% (CAS 850567-51-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119GTQ-1g |
| cas | 850567-51-0 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 870.80 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;hydrochloride (CAS 850567-51-0) is a chemical compound with the molecular formula C12H19BClNO2 and a molecular weight of 255.55 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;hydrochloride. InChIKey: JKYHLNAXOSAGCE-UHFFFAOYSA-N.
| Molecular formula | C12H19BClNO2 |
|---|---|
| Molecular weight | 255.55 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;hydrochloride |
| InChIKey | JKYHLNAXOSAGCE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)