CAS 850567-51-0 appears in our catalog under these names: 3-Aminophenylboronic acid, pinacol ester hydrochloride, 98%, 3-Aminophenylboronic acid, pinacol ester, HCl, ≥98%, ≥98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 5g, 1g.
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;hydrochloride (CAS 850567-51-0) is a chemical compound with the molecular formula C12H19BClNO2 and a molecular weight of 255.55 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;hydrochloride. InChIKey: JKYHLNAXOSAGCE-UHFFFAOYSA-N.
| Molecular formula | C12H19BClNO2 |
|---|---|
| Molecular weight | 255.55 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;hydrochloride |
| InChIKey | JKYHLNAXOSAGCE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)