cas: 1172897-29-8 — see every product listed under this CAS number, including other names
3-Benzylmorpholine hydrochloride, 98%, 98% (CAS 1172897-29-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 50mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111E28-100mg |
| cas | 1172897-29-8 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 50mg | 218.00 Pln | |
| Chemat | 500mg | 698.00 Pln | |
| Chemat | 1g | 789.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-benzylmorpholine;hydrochloride (CAS 1172897-29-8) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 3-benzylmorpholine;hydrochloride. InChIKey: YPBSZAVJNVJGHC-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 3-benzylmorpholine;hydrochloride |
| InChIKey | YPBSZAVJNVJGHC-UHFFFAOYSA-N |
| SMILES | C1COCC(N1)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)