cas: 1005010-03-6 — see every product listed under this CAS number, including other names
3-Benzyloxy-4-methoxyboronic acid, pinacol ester, ≥95%, ≥95% (CAS 1005010-03-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11069I-1g |
| cas | 1005010-03-6 |
| size | 1g |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 3006.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-(4-methoxy-3-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1005010-03-6) is a chemical compound with the molecular formula C20H25BO4 and a molecular weight of 340.2 g/mol. IUPAC name: 2-(4-methoxy-3-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: PNAPHEUGEGSIJQ-UHFFFAOYSA-N.
| Molecular formula | C20H25BO4 |
|---|---|
| Molecular weight | 340.2 g/mol |
| IUPAC name | 2-(4-methoxy-3-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | PNAPHEUGEGSIJQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OC)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)