cas: 1428532-92-6 — see every product listed under this CAS number, including other names
3-Benzyloxy-5-bromo-2-fluoropyridine (CAS 1428532-92-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631976-1G |
| cas | 1428532-92-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1820.21 Pln | |
| Fluorochem | 5g | 5313.77 Pln |
| delivery time | 3-4 weeks |
|---|
5-bromo-2-fluoro-3-phenylmethoxypyridine (CAS 1428532-92-6) is a chemical compound with the molecular formula C12H9BrFNO and a molecular weight of 282.11 g/mol. IUPAC name: 5-bromo-2-fluoro-3-phenylmethoxypyridine. InChIKey: XCCUAQPTKFITSD-UHFFFAOYSA-N.
| Molecular formula | C12H9BrFNO |
|---|---|
| Molecular weight | 282.11 g/mol |
| IUPAC name | 5-bromo-2-fluoro-3-phenylmethoxypyridine |
| InChIKey | XCCUAQPTKFITSD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(N=CC(=C2)Br)F |
Computed by PubChem (NCBI)