CAS 1774887-92-1 appears in our catalog under these names: 3-Bromo-1-(4-fluorobenzyl)pyridin-2(1h)-one, 95%, 3-Bromo-1-(4-fluorobenzyl)pyridin-2(1H)-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
3-bromo-1-[(4-fluorophenyl)methyl]pyridin-2-one (CAS 1774887-92-1) is a chemical compound with the molecular formula C12H9BrFNO and a molecular weight of 282.11 g/mol. IUPAC name: 3-bromo-1-[(4-fluorophenyl)methyl]pyridin-2-one. InChIKey: DGMAHXPEAYYOJF-UHFFFAOYSA-N.
| Molecular formula | C12H9BrFNO |
|---|---|
| Molecular weight | 282.11 g/mol |
| IUPAC name | 3-bromo-1-[(4-fluorophenyl)methyl]pyridin-2-one |
| InChIKey | DGMAHXPEAYYOJF-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)C(=C1)Br)CC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)