cas: 1309981-00-7 — see every product listed under this CAS number, including other names
3-BroMo-2-chloro-6-Methoxyphenylboronic acid (CAS 1309981-00-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111V06-250mg |
| cas | 1309981-00-7 |
| size | 250mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 184.40 Pln |
| delivery time | 3 weeks |
|---|
(3-bromo-2-chloro-6-methoxyphenyl)boronic acid (CAS 1309981-00-7) is a chemical compound with the molecular formula C7H7BBrClO3 and a molecular weight of 265.30 g/mol. IUPAC name: (3-bromo-2-chloro-6-methoxyphenyl)boronic acid. InChIKey: QLIFWSMTZIXOGZ-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrClO3 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (3-bromo-2-chloro-6-methoxyphenyl)boronic acid |
| InChIKey | QLIFWSMTZIXOGZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Cl)Br)OC)(O)O |
Computed by PubChem (NCBI)