cas: 88174-27-0 — see every product listed under this CAS number, including other names
3-Bromo-2,4,6-trimethylbenzaldehyde, ≥95%, ≥95% (CAS 88174-27-0) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115DSQ-1g |
| cas | 88174-27-0 |
| size | 1g |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 3112.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
3-bromo-2,4,6-trimethylbenzaldehyde (CAS 88174-27-0) is a chemical compound with the molecular formula C10H11BrO and a molecular weight of 227.10 g/mol. IUPAC name: 3-bromo-2,4,6-trimethylbenzaldehyde. InChIKey: GHWCNWQBTMHJKU-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO |
|---|---|
| Molecular weight | 227.10 g/mol |
| IUPAC name | 3-bromo-2,4,6-trimethylbenzaldehyde |
| InChIKey | GHWCNWQBTMHJKU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C=O)C)Br)C |
Computed by PubChem (NCBI)