cas: 849052-18-2 — see every product listed under this CAS number, including other names
3-Bromo-2-(4'-chlorobenzyloxy)-5-methylphenylboronic acid, 97%, 97% (CAS 849052-18-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BR6-100mg |
| cas | 849052-18-2 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 141.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[3-bromo-2-[(4-chlorophenyl)methoxy]-5-methylphenyl]boronic acid (CAS 849052-18-2) is a chemical compound with the molecular formula C14H13BBrClO3 and a molecular weight of 355.42 g/mol. IUPAC name: [3-bromo-2-[(4-chlorophenyl)methoxy]-5-methylphenyl]boronic acid. InChIKey: DKUPKFVGBUWCOP-UHFFFAOYSA-N.
| Molecular formula | C14H13BBrClO3 |
|---|---|
| Molecular weight | 355.42 g/mol |
| IUPAC name | [3-bromo-2-[(4-chlorophenyl)methoxy]-5-methylphenyl]boronic acid |
| InChIKey | DKUPKFVGBUWCOP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OCC2=CC=C(C=C2)Cl)Br)C)(O)O |
Computed by PubChem (NCBI)