cas: 1379301-97-9 — see every product listed under this CAS number, including other names
3-Bromo-2-chloro-4-nitropyridine 95% (CAS 1379301-97-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A789242-100mg |
| cas | 1379301-97-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 342.56 Pln | |
| Ambeed | 250mg | 537.25 Pln | |
| Ambeed | 1g | 1188.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A789242 |
3-bromo-2-chloro-4-nitropyridine (CAS 1379301-97-9) is a chemical compound with the molecular formula C5H2BrClN2O2 and a molecular weight of 237.44 g/mol. IUPAC name: 3-bromo-2-chloro-4-nitropyridine. InChIKey: DVOYAFSLONCZPD-UHFFFAOYSA-N.
| Molecular formula | C5H2BrClN2O2 |
|---|---|
| Molecular weight | 237.44 g/mol |
| IUPAC name | 3-bromo-2-chloro-4-nitropyridine |
| InChIKey | DVOYAFSLONCZPD-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1[N+](=O)[O-])Br)Cl |
Computed by PubChem (NCBI)