CAS 31872-63-6 appears in our catalog under these names: 3-Bromo-4-chloro-5-nitropyridine, 97%, 3-Bromo-4-chloro-5-nitropyridine, 95%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 1g, 10g, 5g, 25g, 100g, 500g.
3-bromo-4-chloro-5-nitropyridine (CAS 31872-63-6) is a chemical compound with the molecular formula C5H2BrClN2O2 and a molecular weight of 237.44 g/mol. IUPAC name: 3-bromo-4-chloro-5-nitropyridine. InChIKey: FTQGEZJTBYMEIH-UHFFFAOYSA-N.
| Molecular formula | C5H2BrClN2O2 |
|---|---|
| Molecular weight | 237.44 g/mol |
| IUPAC name | 3-bromo-4-chloro-5-nitropyridine |
| InChIKey | FTQGEZJTBYMEIH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Br)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)