cas: 1804841-26-6 — see every product listed under this CAS number, including other names
3-Bromo-2-fluoro-6-nitroaniline, 97% (CAS 1804841-26-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A156185-5g |
| cas | 1804841-26-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8865.01 Pln | |
| Fluorochem | 100mg | 1445.34 Pln | |
| Fluorochem | 250mg | 1903.51 Pln | |
| Fluorochem | 500mg | 3127.04 Pln | |
| Fluorochem | 1g | 4642.13 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-bromo-2-fluoro-6-nitroaniline (CAS 1804841-26-6) is a chemical compound with the molecular formula C6H4BrFN2O2 and a molecular weight of 235.01 g/mol. IUPAC name: 3-bromo-2-fluoro-6-nitroaniline. InChIKey: SCAQBSHGBYKWET-UHFFFAOYSA-N.
| Molecular formula | C6H4BrFN2O2 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 3-bromo-2-fluoro-6-nitroaniline |
| InChIKey | SCAQBSHGBYKWET-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])N)F)Br |
Computed by PubChem (NCBI)