cas: 1261777-18-7 — see every product listed under this CAS number, including other names
3-Bromo-2-nitrobenzonitrile 98% (CAS 1261777-18-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A342806-250mg |
| cas | 1261777-18-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 442.69 Pln | |
| Ambeed | 5g | 1366.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A342806 |
3-bromo-2-nitrobenzonitrile (CAS 1261777-18-7) is a chemical compound with the molecular formula C7H3BrN2O2 and a molecular weight of 227.01 g/mol. IUPAC name: 3-bromo-2-nitrobenzonitrile. InChIKey: GRJNIVGBEWRZQY-UHFFFAOYSA-N.
| Molecular formula | C7H3BrN2O2 |
|---|---|
| Molecular weight | 227.01 g/mol |
| IUPAC name | 3-bromo-2-nitrobenzonitrile |
| InChIKey | GRJNIVGBEWRZQY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)