Products 1261777-18-7
CAS 1261777-18-7 appears in our catalog under these names: 3-Bromo-2-nitrobenzonitrile, 95%, 3-Bromo-2-nitrobenzonitrile 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 250mg, 5g.
3-bromo-2-nitrobenzonitrile (CAS 1261777-18-7) is a chemical compound with the molecular formula C7H3BrN2O2 and a molecular weight of 227.01 g/mol. IUPAC name: 3-bromo-2-nitrobenzonitrile. InChIKey: GRJNIVGBEWRZQY-UHFFFAOYSA-N.
| Molecular formula | C7H3BrN2O2 |
|---|---|
| Molecular weight | 227.01 g/mol |
| IUPAC name | 3-bromo-2-nitrobenzonitrile |
| InChIKey | GRJNIVGBEWRZQY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)