cas: 886496-88-4 — see every product listed under this CAS number, including other names
3-Bromo-4-(trifluoromethoxy)phenol 98% (CAS 886496-88-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A359173-10g |
| cas | 886496-88-4 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 537.25 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 303.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A359173 |
3-bromo-4-(trifluoromethoxy)phenol (CAS 886496-88-4) is a chemical compound with the molecular formula C7H4BrF3O2 and a molecular weight of 257.00 g/mol. IUPAC name: 3-bromo-4-(trifluoromethoxy)phenol. InChIKey: GVPNWQKCKBFPBG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3O2 |
|---|---|
| Molecular weight | 257.00 g/mol |
| IUPAC name | 3-bromo-4-(trifluoromethoxy)phenol |
| InChIKey | GVPNWQKCKBFPBG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)Br)OC(F)(F)F |
Computed by PubChem (NCBI)