cas: 31872-63-6 — see every product listed under this CAS number, including other names
3-Bromo-4-chloro-5-nitropyridine 95% (CAS 31872-63-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A282918-1g |
| cas | 31872-63-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 159.00 Pln | |
| Ambeed | 10g | 181.25 Pln | |
| Ambeed | 25g | 342.56 Pln | |
| Ambeed | 100g | 1060.12 Pln | |
| Ambeed | 500g | 5015.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A282918 |
3-bromo-4-chloro-5-nitropyridine (CAS 31872-63-6) is a chemical compound with the molecular formula C5H2BrClN2O2 and a molecular weight of 237.44 g/mol. IUPAC name: 3-bromo-4-chloro-5-nitropyridine. InChIKey: FTQGEZJTBYMEIH-UHFFFAOYSA-N.
| Molecular formula | C5H2BrClN2O2 |
|---|---|
| Molecular weight | 237.44 g/mol |
| IUPAC name | 3-bromo-4-chloro-5-nitropyridine |
| InChIKey | FTQGEZJTBYMEIH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Br)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)