3-Bromo-4-chloro-6-methoxyquinoline, 98%
cas: 1203579-29-6 — see every product listed under this CAS number, including other names
3-Bromo-4-chloro-6-methoxyquinoline, 98% (CAS 1203579-29-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A399954-250mg |
| cas | 1203579-29-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 587.31 Pln | |
| Ambeed | 1g | 1377.19 Pln | |
| Ambeed | 5g | 3986.00 Pln | |
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 424.40 Pln | |
| Chemat | 1g | 986.00 Pln | |
| BLDpharm | 100mg | 458.75 Pln | |
| BLDpharm | 250mg | 630.91 Pln | |
| BLDpharm | 1g | 1480.61 Pln | |
| BLDpharm | 5g | 4290.74 Pln | |
| Fluorochem | 100mg | 102.06 Pln | |
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 325.94 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
3-bromo-4-chloro-6-methoxyquinoline (CAS 1203579-29-6) is a chemical compound with the molecular formula C10H7BrClNO and a molecular weight of 272.52 g/mol. IUPAC name: 3-bromo-4-chloro-6-methoxyquinoline. InChIKey: JPJOZOXSMAFCSD-UHFFFAOYSA-N.
| Molecular formula | C10H7BrClNO |
|---|---|
| Molecular weight | 272.52 g/mol |
| IUPAC name | 3-bromo-4-chloro-6-methoxyquinoline |
| InChIKey | JPJOZOXSMAFCSD-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=CN=C2C=C1)Br)Cl |
Computed by PubChem (NCBI)