cas: 1203579-29-6 — see every product listed under this CAS number, including other names
3-Bromo-4-chloro-6-methoxyquinoline, 98% (CAS 1203579-29-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F608209-100MG |
| cas | 1203579-29-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 96.86 Pln | |
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 310.33 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-4-chloro-6-methoxyquinoline (CAS 1203579-29-6) is a chemical compound with the molecular formula C10H7BrClNO and a molecular weight of 272.52 g/mol. IUPAC name: 3-bromo-4-chloro-6-methoxyquinoline. InChIKey: JPJOZOXSMAFCSD-UHFFFAOYSA-N.
| Molecular formula | C10H7BrClNO |
|---|---|
| Molecular weight | 272.52 g/mol |
| IUPAC name | 3-bromo-4-chloro-6-methoxyquinoline |
| InChIKey | JPJOZOXSMAFCSD-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=CN=C2C=C1)Br)Cl |
Computed by PubChem (NCBI)