CAS 22091-38-9 appears in our catalog under these names: 2-(4-Bromophenyl)-4-(chloromethyl)-1,3-oxazole, 95%, 2-(4-Bromophenyl)-4-(chloromethyl)-1,3-oxazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g.
2-(4-bromophenyl)-4-(chloromethyl)-1,3-oxazole (CAS 22091-38-9) is a chemical compound with the molecular formula C10H7BrClNO and a molecular weight of 272.52 g/mol. IUPAC name: 2-(4-bromophenyl)-4-(chloromethyl)-1,3-oxazole. InChIKey: KZSDQYSWKWLFJE-UHFFFAOYSA-N.
| Molecular formula | C10H7BrClNO |
|---|---|
| Molecular weight | 272.52 g/mol |
| IUPAC name | 2-(4-bromophenyl)-4-(chloromethyl)-1,3-oxazole |
| InChIKey | KZSDQYSWKWLFJE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CO2)CCl)Br |
Computed by PubChem (NCBI)