cas: 102000-73-7 — see every product listed under this CAS number, including other names
3-Bromo-4-nitrobenzonitrile, 97%, 97% (CAS 102000-73-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11170O-100mg |
| cas | 102000-73-7 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 818.00 Pln | |
| Chemat | 25g | 2699.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-bromo-4-nitrobenzonitrile (CAS 102000-73-7) is a chemical compound with the molecular formula C7H3BrN2O2 and a molecular weight of 227.01 g/mol. IUPAC name: 3-bromo-4-nitrobenzonitrile. InChIKey: RNDBDEZITHKFEU-UHFFFAOYSA-N.
| Molecular formula | C7H3BrN2O2 |
|---|---|
| Molecular weight | 227.01 g/mol |
| IUPAC name | 3-bromo-4-nitrobenzonitrile |
| InChIKey | RNDBDEZITHKFEU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)