cas: 479411-96-6 — see every product listed under this CAS number, including other names
3-Bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 98%, 98% (CAS 479411-96-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DPSE-100mg |
| cas | 479411-96-6 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 280.40 Pln | |
| Chemat | 250mg | 429.20 Pln | |
| Chemat | 1g | 798.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 479411-96-6) is a chemical compound with the molecular formula C13H15BBrNO2 and a molecular weight of 307.98 g/mol. IUPAC name: 3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: RXYJIHWLAKWJTK-UHFFFAOYSA-N.
| Molecular formula | C13H15BBrNO2 |
|---|---|
| Molecular weight | 307.98 g/mol |
| IUPAC name | 3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | RXYJIHWLAKWJTK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Br)C#N |
Computed by PubChem (NCBI)