CAS 863868-20-6 appears in our catalog under these names: 5-Bromo-2-cyanophenylboronic acid pinacol ester, 96%, 5-Bromo-2-cyanophenylboronic acid pinacol ester, 96%, 96%, 4-Bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 863868-20-6) is a chemical compound with the molecular formula C13H15BBrNO2 and a molecular weight of 307.98 g/mol. IUPAC name: 4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: BFFOEKGRPYYDIR-UHFFFAOYSA-N.
| Molecular formula | C13H15BBrNO2 |
|---|---|
| Molecular weight | 307.98 g/mol |
| IUPAC name | 4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | BFFOEKGRPYYDIR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)Br)C#N |
Computed by PubChem (NCBI)