cas: 452972-07-5 — see every product listed under this CAS number, including other names
3-Bromo-5-(4-methoxyphenyl)pyridine, 95+% (CAS 452972-07-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A956722-5g |
| cas | 452972-07-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 13187.65 Pln | |
| AmBeed | 10g | 22412.32 Pln | |
| AmBeed | 25g | 43992.97 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-bromo-5-(4-methoxyphenyl)pyridine (CAS 452972-07-5) is a chemical compound with the molecular formula C12H10BrNO and a molecular weight of 264.12 g/mol. IUPAC name: 3-bromo-5-(4-methoxyphenyl)pyridine. InChIKey: NMABCNUNSGFELM-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO |
|---|---|
| Molecular weight | 264.12 g/mol |
| IUPAC name | 3-bromo-5-(4-methoxyphenyl)pyridine |
| InChIKey | NMABCNUNSGFELM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)