cas: 79456-30-7 — see every product listed under this CAS number, including other names
3-Bromo-5-(trifluoromethyl)pyridin-2-amine, 98%, 98% (CAS 79456-30-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1162TP-250mg |
| cas | 79456-30-7 |
| size | 250mg |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 218.00 Pln | |
| Chemat | 100g | 693.20 Pln | |
| Chemat | 500g | 2894.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-bromo-5-(trifluoromethyl)pyridin-2-amine (CAS 79456-30-7) is a chemical compound with the molecular formula C6H4BrF3N2 and a molecular weight of 241.01 g/mol. IUPAC name: 3-bromo-5-(trifluoromethyl)pyridin-2-amine. InChIKey: KBNACDZKKVMULE-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF3N2 |
|---|---|
| Molecular weight | 241.01 g/mol |
| IUPAC name | 3-bromo-5-(trifluoromethyl)pyridin-2-amine |
| InChIKey | KBNACDZKKVMULE-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Br)N)C(F)(F)F |
Computed by PubChem (NCBI)