cas: 1328062-78-7 — see every product listed under this CAS number, including other names
3-Bromo-5-chloro-N-cyclopropylbenzamide (CAS 1328062-78-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F629939-1G |
| cas | 1328062-78-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2861.51 Pln | |
| Fluorochem | 5g | 8442.88 Pln |
| delivery time | 3-4 weeks |
|---|
3-bromo-5-chloro-N-cyclopropylbenzamide (CAS 1328062-78-7) is a chemical compound with the molecular formula C10H9BrClNO and a molecular weight of 274.54 g/mol. IUPAC name: 3-bromo-5-chloro-N-cyclopropylbenzamide. InChIKey: ARLNMTYTDIFAGA-UHFFFAOYSA-N.
| Molecular formula | C10H9BrClNO |
|---|---|
| Molecular weight | 274.54 g/mol |
| IUPAC name | 3-bromo-5-chloro-N-cyclopropylbenzamide |
| InChIKey | ARLNMTYTDIFAGA-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=CC(=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)