cas: 1026796-58-6 — see every product listed under this CAS number, including other names
3-Bromo-5-fluoro-2-isopropoxyphenol, 95+% (CAS 1026796-58-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A874223-25g |
| cas | 1026796-58-6 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 19196.38 Pln | |
| AmBeed | 5g | 5824.84 Pln | |
| AmBeed | 10g | 9802.45 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-bromo-5-fluoro-2-propan-2-yloxyphenol (CAS 1026796-58-6) is a chemical compound with the molecular formula C9H10BrFO2 and a molecular weight of 249.08 g/mol. IUPAC name: 3-bromo-5-fluoro-2-propan-2-yloxyphenol. InChIKey: AEQOJSGAXJOPBR-UHFFFAOYSA-N.
| Molecular formula | C9H10BrFO2 |
|---|---|
| Molecular weight | 249.08 g/mol |
| IUPAC name | 3-bromo-5-fluoro-2-propan-2-yloxyphenol |
| InChIKey | AEQOJSGAXJOPBR-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1Br)F)O |
Computed by PubChem (NCBI)