CAS 1298085-64-9 is the registry number for 1-Bromo-4-(dimethoxymethyl)-2-fluorobenzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
1-bromo-4-(dimethoxymethyl)-2-fluorobenzene (CAS 1298085-64-9) is a chemical compound with the molecular formula C9H10BrFO2 and a molecular weight of 249.08 g/mol. IUPAC name: 1-bromo-4-(dimethoxymethyl)-2-fluorobenzene. InChIKey: GQDGRHVADZRANV-UHFFFAOYSA-N.
| Molecular formula | C9H10BrFO2 |
|---|---|
| Molecular weight | 249.08 g/mol |
| IUPAC name | 1-bromo-4-(dimethoxymethyl)-2-fluorobenzene |
| InChIKey | GQDGRHVADZRANV-UHFFFAOYSA-N |
| SMILES | COC(C1=CC(=C(C=C1)Br)F)OC |
Computed by PubChem (NCBI)