cas: 1346809-61-7 — see every product listed under this CAS number, including other names
3-Bromo-5H-pyrrolo[3,4-b]pyridin-7(6H)-one 95% (CAS 1346809-61-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A115002-100mg |
| cas | 1346809-61-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 743.06 Pln | |
| Ambeed | 1g | 1666.44 Pln | |
| Ambeed | 5g | 4520.00 Pln | |
| Ambeed | 10g | 7457.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A115002 |
3-bromo-5,6-dihydropyrrolo[3,4-b]pyridin-7-one (CAS 1346809-61-7) is a chemical compound with the molecular formula C7H5BrN2O and a molecular weight of 213.03 g/mol. IUPAC name: 3-bromo-5,6-dihydropyrrolo[3,4-b]pyridin-7-one. InChIKey: MIVZJHZGDCIYBT-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O |
|---|---|
| Molecular weight | 213.03 g/mol |
| IUPAC name | 3-bromo-5,6-dihydropyrrolo[3,4-b]pyridin-7-one |
| InChIKey | MIVZJHZGDCIYBT-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=O)N1)N=CC(=C2)Br |
Computed by PubChem (NCBI)