CAS 1346809-61-7 appears in our catalog under these names: 3-Bromo-5h-pyrrolo[3,4-b]pyridin-7(6h)-one, 95%, 3-Bromo-5H-pyrrolo[3,4-b]pyridin-7(6H)-one, 97%, 97%, 3-BROMO-5H-PYRROLO[3,4-B]PYRIDIN-7(6H)-ONE, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg, 500mg, 10g.
3-bromo-5,6-dihydropyrrolo[3,4-b]pyridin-7-one (CAS 1346809-61-7) is a chemical compound with the molecular formula C7H5BrN2O and a molecular weight of 213.03 g/mol. IUPAC name: 3-bromo-5,6-dihydropyrrolo[3,4-b]pyridin-7-one. InChIKey: MIVZJHZGDCIYBT-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O |
|---|---|
| Molecular weight | 213.03 g/mol |
| IUPAC name | 3-bromo-5,6-dihydropyrrolo[3,4-b]pyridin-7-one |
| InChIKey | MIVZJHZGDCIYBT-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=O)N1)N=CC(=C2)Br |
Computed by PubChem (NCBI)