cas: 1289124-13-5 — see every product listed under this CAS number, including other names
3-Bromo-6-isobutoxy-2-methylpyridine, 95+% (CAS 1289124-13-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A670516-25g |
| cas | 1289124-13-5 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 35191.45 Pln | |
| AmBeed | 5g | 10564.12 Pln | |
| AmBeed | 10g | 17926.93 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-bromo-2-methyl-6-(2-methylpropoxy)pyridine (CAS 1289124-13-5) is a chemical compound with the molecular formula C10H14BrNO and a molecular weight of 244.13 g/mol. IUPAC name: 3-bromo-2-methyl-6-(2-methylpropoxy)pyridine. InChIKey: SMCNLSVUURAZRM-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO |
|---|---|
| Molecular weight | 244.13 g/mol |
| IUPAC name | 3-bromo-2-methyl-6-(2-methylpropoxy)pyridine |
| InChIKey | SMCNLSVUURAZRM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)OCC(C)C)Br |
Computed by PubChem (NCBI)