CAS 1255574-44-7 is the registry number for 3-Bromo-2-isobutoxy-5-methylpyridine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 100g, 1g.
3-bromo-5-methyl-2-(2-methylpropoxy)pyridine (CAS 1255574-44-7) is a chemical compound with the molecular formula C10H14BrNO and a molecular weight of 244.13 g/mol. IUPAC name: 3-bromo-5-methyl-2-(2-methylpropoxy)pyridine. InChIKey: DKFRYGABMPQDQQ-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO |
|---|---|
| Molecular weight | 244.13 g/mol |
| IUPAC name | 3-bromo-5-methyl-2-(2-methylpropoxy)pyridine |
| InChIKey | DKFRYGABMPQDQQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)OCC(C)C)Br |
Computed by PubChem (NCBI)