cas: 1686108-69-9 — see every product listed under this CAS number, including other names
3-Bromo-7,8-difluoroquinoline, 98%, 98% (CAS 1686108-69-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112Y6T-100mg |
| cas | 1686108-69-9 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 554.00 Pln | |
| Chemat | 250mg | 846.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-bromo-7,8-difluoroquinoline (CAS 1686108-69-9) is a chemical compound with the molecular formula C9H4BrF2N and a molecular weight of 244.03 g/mol. IUPAC name: 3-bromo-7,8-difluoroquinoline. InChIKey: PNUVUICRKMWGRS-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF2N |
|---|---|
| Molecular weight | 244.03 g/mol |
| IUPAC name | 3-bromo-7,8-difluoroquinoline |
| InChIKey | PNUVUICRKMWGRS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=NC=C(C=C21)Br)F)F |
Computed by PubChem (NCBI)