CAS 1189106-43-1 appears in our catalog under these names: 4-Bromo-7,8-difluoroquinoline, 95%, 4-Bromo-7,8-difluoroquinoline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4-bromo-7,8-difluoroquinoline (CAS 1189106-43-1) is a chemical compound with the molecular formula C9H4BrF2N and a molecular weight of 244.03 g/mol. IUPAC name: 4-bromo-7,8-difluoroquinoline. InChIKey: XMRWACGSQHZGJV-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF2N |
|---|---|
| Molecular weight | 244.03 g/mol |
| IUPAC name | 4-bromo-7,8-difluoroquinoline |
| InChIKey | XMRWACGSQHZGJV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=NC=CC(=C21)Br)F)F |
Computed by PubChem (NCBI)