CAS 1547491-70-2 appears in our catalog under these names: 3–Bromo–9,9–diphenyl–9H–fluorene, 3-Bromo-9,9-diphenyl-9H-fluorene, >98.0%(GC), 3-Bromo-9,9-diphenyl-9H-fluorene, 98%, 98%, 3-Bromo-9,9-diphenyl-9H-fluorene, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g.
3-bromo-9,9-diphenylfluorene (CAS 1547491-70-2) is a chemical compound with the molecular formula C25H17Br and a molecular weight of 397.3 g/mol. IUPAC name: 3-bromo-9,9-diphenylfluorene. InChIKey: AXVLLFWWMWDULG-UHFFFAOYSA-N.
| Molecular formula | C25H17Br |
|---|---|
| Molecular weight | 397.3 g/mol |
| IUPAC name | 3-bromo-9,9-diphenylfluorene |
| InChIKey | AXVLLFWWMWDULG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C3=C(C=C(C=C3)Br)C4=CC=CC=C42)C5=CC=CC=C5 |
Computed by PubChem (NCBI)