CAS 474918-32-6 appears in our catalog under these names: 2–Bromo–9,9–diphenylfluorene, 2-Bromo-9,9-diphenylfluorene, >98.0%(GC), 2-Bromo-9,9-diphenyl-9H-fluorene 98%, 2-Bromo-9,9-diphenyl-9H-fluorene, 99%, 99%, 2-Bromo-9,9-diphenyl-9H-fluorene, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 500g, 50g.
2-bromo-9,9-diphenylfluorene (CAS 474918-32-6) is a chemical compound with the molecular formula C25H17Br and a molecular weight of 397.3 g/mol. IUPAC name: 2-bromo-9,9-diphenylfluorene. InChIKey: WNXNWOBGPRKOJF-UHFFFAOYSA-N.
| Molecular formula | C25H17Br |
|---|---|
| Molecular weight | 397.3 g/mol |
| IUPAC name | 2-bromo-9,9-diphenylfluorene |
| InChIKey | WNXNWOBGPRKOJF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C3=CC=CC=C3C4=C2C=C(C=C4)Br)C5=CC=CC=C5 |
Computed by PubChem (NCBI)